C14H17FO2 — CID 83922757
1-fluoro-4,5-dimethoxy-2-(2-methylpent-3-ynyl)benzene (PubChem CID 83922757) has the molecular formula C14H17FO2 and a molecular weight of 236.29 g/mol. Its IUPAC name is 1-fluoro-4,5-dimethoxy-2-(2-methylpent-3-ynyl)benzene.
| Compound Name | 1-fluoro-4,5-dimethoxy-2-(2-methylpent-3-ynyl)benzene |
|---|---|
| PubChem CID | 83922757 |
| Molecular Formula | C14H17FO2 |
| Molecular Weight | 236.29 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 1-fluoro-4,5-dimethoxy-2-(2-methylpent-3-ynyl)benzene |
| SMILES | CC#CC(C)Cc1cc(OC)c(OC)cc1F |
| InChI | InChI=1S/C14H17FO2/c1-5-6-10(2)7-11-8-13(16-3)14(17-4)9-12(11)15/h8-10H,7H2,1-4H3 |
| InChIKey | APDXEFQTCLLIGJ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.29 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|