C11H12F2O2 — CID 123625803
1-fluoro-2-(3-fluoroprop-2-enyl)-4,5-dimethoxybenzene (PubChem CID 123625803) has the molecular formula C11H12F2O2 and a molecular weight of 214.21 g/mol. Its IUPAC name is 1-fluoro-2-(3-fluoroprop-2-enyl)-4,5-dimethoxybenzene.
| Compound Name | 1-fluoro-2-(3-fluoroprop-2-enyl)-4,5-dimethoxybenzene |
|---|---|
| PubChem CID | 123625803 |
| Molecular Formula | C11H12F2O2 |
| Molecular Weight | 214.21 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | 1-fluoro-2-(3-fluoroprop-2-enyl)-4,5-dimethoxybenzene |
| SMILES | COc1cc(F)c(CC=CF)cc1OC |
| InChI | InChI=1S/C11H12F2O2/c1-14-10-6-8(4-3-5-12)9(13)7-11(10)15-2/h3,5-7H,4H2,1-2H3 |
| InChIKey | KIJBZQXBUINDLZ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.21 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |