C17H23ClO2 — CID 83943459
1-chloro-2,4-diethoxy-5-(2-methylhex-3-ynyl)benzene (PubChem CID 83943459) has the molecular formula C17H23ClO2 and a molecular weight of 294.82 g/mol. Its IUPAC name is 1-chloro-2,4-diethoxy-5-(2-methylhex-3-ynyl)benzene.
| Compound Name | 1-chloro-2,4-diethoxy-5-(2-methylhex-3-ynyl)benzene |
|---|---|
| PubChem CID | 83943459 |
| Molecular Formula | C17H23ClO2 |
| Molecular Weight | 294.82 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | 1-chloro-2,4-diethoxy-5-(2-methylhex-3-ynyl)benzene |
| SMILES | CCC#CC(C)Cc1cc(Cl)c(OCC)cc1OCC |
| InChI | InChI=1S/C17H23ClO2/c1-5-8-9-13(4)10-14-11-15(18)17(20-7-3)12-16(14)19-6-2/h11-13H,5-7,10H2,1-4H3 |
| InChIKey | GVLAJOIDODNMIL-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.82 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|