C17H24 — CID 83920970
1,4-diethyl-2-(2-methylhex-3-ynyl)benzene (PubChem CID 83920970) has the molecular formula C17H24 and a molecular weight of 228.38 g/mol. Its IUPAC name is 1,4-diethyl-2-(2-methylhex-3-ynyl)benzene.
| Compound Name | 1,4-diethyl-2-(2-methylhex-3-ynyl)benzene |
|---|---|
| PubChem CID | 83920970 |
| Molecular Formula | C17H24 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.19 |
| IUPAC Name | 1,4-diethyl-2-(2-methylhex-3-ynyl)benzene |
| SMILES | CCC#CC(C)Cc1cc(CC)ccc1CC |
| InChI | InChI=1S/C17H24/c1-5-8-9-14(4)12-17-13-15(6-2)10-11-16(17)7-3/h10-11,13-14H,5-7,12H2,1-4H3 |
| InChIKey | MHIPHWQEOVEYMR-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|