C17H26O — CID 83920999
2-[1-(2,5-diethylphenyl)propan-2-yl]-3-ethyloxirane (PubChem CID 83920999) has the molecular formula C17H26O and a molecular weight of 246.39 g/mol. Its IUPAC name is 2-[1-(2,5-diethylphenyl)propan-2-yl]-3-ethyloxirane.
| Compound Name | 2-[1-(2,5-diethylphenyl)propan-2-yl]-3-ethyloxirane |
|---|---|
| PubChem CID | 83920999 |
| Molecular Formula | C17H26O |
| Molecular Weight | 246.39 g/mol |
| Exact Mass | 246.20 |
| IUPAC Name | 2-[1-(2,5-diethylphenyl)propan-2-yl]-3-ethyloxirane |
| SMILES | CCc1ccc(CC)c(CC(C)C2OC2CC)c1 |
| InChI | InChI=1S/C17H26O/c1-5-13-8-9-14(6-2)15(11-13)10-12(4)17-16(7-3)18-17/h8-9,11-12,16-17H,5-7,10H2,1-4H3 |
| InChIKey | WKYLCZHOVFRGBS-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.39 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|