C18H28O — CID 83939257
2-[1-(3-tert-butyl-4-methylphenyl)propan-2-yl]-3-ethyloxirane (PubChem CID 83939257) has the molecular formula C18H28O and a molecular weight of 260.42 g/mol. Its IUPAC name is 2-[1-(3-tert-butyl-4-methylphenyl)propan-2-yl]-3-ethyloxirane.
| Compound Name | 2-[1-(3-tert-butyl-4-methylphenyl)propan-2-yl]-3-ethyloxirane |
|---|---|
| PubChem CID | 83939257 |
| Molecular Formula | C18H28O |
| Molecular Weight | 260.42 g/mol |
| Exact Mass | 260.21 |
| IUPAC Name | 2-[1-(3-tert-butyl-4-methylphenyl)propan-2-yl]-3-ethyloxirane |
| SMILES | CCC1OC1C(C)Cc1ccc(C)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C18H28O/c1-7-16-17(19-16)13(3)10-14-9-8-12(2)15(11-14)18(4,5)6/h8-9,11,13,16-17H,7,10H2,1-6H3 |
| InChIKey | MGKNNVABIBJVIB-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.42 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|