C15H19F3O2 — CID 83921126
2-ethyl-3-[1-[2-methoxy-5-(trifluoromethyl)phenyl]propan-2-yl]oxirane (PubChem CID 83921126) has the molecular formula C15H19F3O2 and a molecular weight of 288.31 g/mol. Its IUPAC name is 2-ethyl-3-[1-[2-methoxy-5-(trifluoromethyl)phenyl]propan-2-yl]oxirane.
| Compound Name | 2-ethyl-3-[1-[2-methoxy-5-(trifluoromethyl)phenyl]propan-2-yl]oxirane |
|---|---|
| PubChem CID | 83921126 |
| Molecular Formula | C15H19F3O2 |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | 2-ethyl-3-[1-[2-methoxy-5-(trifluoromethyl)phenyl]propan-2-yl]oxirane |
| SMILES | CCC1OC1C(C)Cc1cc(C(F)(F)F)ccc1OC |
| InChI | InChI=1S/C15H19F3O2/c1-4-12-14(20-12)9(2)7-10-8-11(15(16,17)18)5-6-13(10)19-3/h5-6,8-9,12,14H,4,7H2,1-3H3 |
| InChIKey | PFCBQGOVJLWIPP-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|