C13H15F3O2 — CID 83921462
2-[2-[2-methoxy-4-(trifluoromethyl)phenyl]ethyl]-3-methyloxirane (PubChem CID 83921462) has the molecular formula C13H15F3O2 and a molecular weight of 260.25 g/mol. Its IUPAC name is 2-[2-[2-methoxy-4-(trifluoromethyl)phenyl]ethyl]-3-methyloxirane.
| Compound Name | 2-[2-[2-methoxy-4-(trifluoromethyl)phenyl]ethyl]-3-methyloxirane |
|---|---|
| PubChem CID | 83921462 |
| Molecular Formula | C13H15F3O2 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 2-[2-[2-methoxy-4-(trifluoromethyl)phenyl]ethyl]-3-methyloxirane |
| SMILES | COc1cc(C(F)(F)F)ccc1CCC1OC1C |
| InChI | InChI=1S/C13H15F3O2/c1-8-11(18-8)6-4-9-3-5-10(13(14,15)16)7-12(9)17-2/h3,5,7-8,11H,4,6H2,1-2H3 |
| InChIKey | NFUZOLPHLYBZGF-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|