C17H18F3NO2 — CID 168972893
2-[[2-[2-methoxy-4-(trifluoromethyl)phenyl]ethylamino]methyl]phenol (PubChem CID 168972893) has the molecular formula C17H18F3NO2 and a molecular weight of 325.33 g/mol. Its IUPAC name is 2-[[2-[2-methoxy-4-(trifluoromethyl)phenyl]ethylamino]methyl]phenol.
| Compound Name | 2-[[2-[2-methoxy-4-(trifluoromethyl)phenyl]ethylamino]methyl]phenol |
|---|---|
| PubChem CID | 168972893 |
| Molecular Formula | C17H18F3NO2 |
| Molecular Weight | 325.33 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 2-[[2-[2-methoxy-4-(trifluoromethyl)phenyl]ethylamino]methyl]phenol |
| SMILES | COc1cc(C(F)(F)F)ccc1CCNCc1ccccc1O |
| InChI | InChI=1S/C17H18F3NO2/c1-23-16-10-14(17(18,19)20)7-6-12(16)8-9-21-11-13-4-2-3-5-15(13)22/h2-7,10,21-22H,8-9,11H2,1H3 |
| InChIKey | WRUXIECVFFQVRD-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.33 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|