C17H20INO3 — CID 10001761
2-[[2-(4-iodo-2,5-dimethoxyphenyl)ethylamino]methyl]phenol (PubChem CID 10001761) has the molecular formula C17H20INO3 and a molecular weight of 413.26 g/mol. Its IUPAC name is 2-[[2-(4-iodo-2,5-dimethoxyphenyl)ethylamino]methyl]phenol.
| Compound Name | 2-[[2-(4-iodo-2,5-dimethoxyphenyl)ethylamino]methyl]phenol |
|---|---|
| PubChem CID | 10001761 |
| Molecular Formula | C17H20INO3 |
| Molecular Weight | 413.26 g/mol |
| Exact Mass | 413.05 |
| IUPAC Name | 2-[[2-(4-iodo-2,5-dimethoxyphenyl)ethylamino]methyl]phenol |
| SMILES | COc1cc(CCNCc2ccccc2O)c(OC)cc1I |
| InChI | InChI=1S/C17H20INO3/c1-21-16-10-14(18)17(22-2)9-12(16)7-8-19-11-13-5-3-4-6-15(13)20/h3-6,9-10,19-20H,7-8,11H2,1-2H3 |
| InChIKey | FEUZHYRXGQTBRO-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.26 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|