C19H26N2O4S — CID 171797156
2-[2,5-dimethoxy-4-(methylsulfonimidoyl)phenyl]-N-[(2-methoxyphenyl)methyl]ethanamine (PubChem CID 171797156) has the molecular formula C19H26N2O4S and a molecular weight of 378.49 g/mol. Its IUPAC name is 2-[2,5-dimethoxy-4-(methylsulfonimidoyl)phenyl]-N-[(2-methoxyphenyl)methyl]ethanamine.
| Compound Name | 2-[2,5-dimethoxy-4-(methylsulfonimidoyl)phenyl]-N-[(2-methoxyphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 171797156 |
| Molecular Formula | C19H26N2O4S |
| Molecular Weight | 378.49 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | 2-[2,5-dimethoxy-4-(methylsulfonimidoyl)phenyl]-N-[(2-methoxyphenyl)methyl]ethanamine |
| SMILES | [H]N=S(C)(=O)c1cc(OC)c(CCNCc2ccccc2OC)cc1OC |
| InChI | InChI=1S/C19H26N2O4S/c1-23-16-8-6-5-7-15(16)13-21-10-9-14-11-18(25-3)19(26(4,20)22)12-17(14)24-2/h5-8,11-12,20-21H,9-10,13H2,1-4H3 |
| InChIKey | RLCPCENWWRORFI-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.49 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|