C22H22F3NO2 — CID 166130267
2-[2,5-dimethoxy-4-(trifluoromethyl)phenyl]-N-(naphthalen-1-ylmethyl)ethanamine (PubChem CID 166130267) has the molecular formula C22H22F3NO2 and a molecular weight of 389.42 g/mol. Its IUPAC name is 2-[2,5-dimethoxy-4-(trifluoromethyl)phenyl]-N-(naphthalen-1-ylmethyl)ethanamine.
| Compound Name | 2-[2,5-dimethoxy-4-(trifluoromethyl)phenyl]-N-(naphthalen-1-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 166130267 |
| Molecular Formula | C22H22F3NO2 |
| Molecular Weight | 389.42 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | 2-[2,5-dimethoxy-4-(trifluoromethyl)phenyl]-N-(naphthalen-1-ylmethyl)ethanamine |
| SMILES | COc1cc(C(F)(F)F)c(OC)cc1CCNCc1cccc2ccccc12 |
| InChI | InChI=1S/C22H22F3NO2/c1-27-20-13-19(22(23,24)25)21(28-2)12-16(20)10-11-26-14-17-8-5-7-15-6-3-4-9-18(15)17/h3-9,12-13,26H,10-11,14H2,1-2H3 |
| InChIKey | WRPLAKNTNLOYBG-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.42 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|