C22H30F3NO3 — CID 144539777
ethane;2-methoxy-4-[3-[[2-methoxy-4-(trifluoromethyl)phenyl]methylamino]butyl]phenol (PubChem CID 144539777) has the molecular formula C22H30F3NO3 and a molecular weight of 413.48 g/mol. Its IUPAC name is ethane;2-methoxy-4-[3-[[2-methoxy-4-(trifluoromethyl)phenyl]methylamino]butyl]phenol.
| Compound Name | ethane;2-methoxy-4-[3-[[2-methoxy-4-(trifluoromethyl)phenyl]methylamino]butyl]phenol |
|---|---|
| PubChem CID | 144539777 |
| Molecular Formula | C22H30F3NO3 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | ethane;2-methoxy-4-[3-[[2-methoxy-4-(trifluoromethyl)phenyl]methylamino]butyl]phenol |
| SMILES | CC.COc1cc(CCC(C)NCc2ccc(C(F)(F)F)cc2OC)ccc1O |
| InChI | InChI=1S/C20H24F3NO3.C2H6/c1-13(4-5-14-6-9-17(25)19(10-14)27-3)24-12-15-7-8-16(20(21,22)23)11-18(15)26-2;1-2/h6-11,13,24-25H,4-5,12H2,1-3H3;1-2H3 |
| InChIKey | DRLQYDFUUWGGBF-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |