C20H24F3NO2 — CID 71277035
2-methoxy-4-[3-methyl-3-[[4-(trifluoromethyl)phenyl]methylamino]butyl]phenol (PubChem CID 71277035) has the molecular formula C20H24F3NO2 and a molecular weight of 367.41 g/mol. Its IUPAC name is 2-methoxy-4-[3-methyl-3-[[4-(trifluoromethyl)phenyl]methylamino]butyl]phenol.
| Compound Name | 2-methoxy-4-[3-methyl-3-[[4-(trifluoromethyl)phenyl]methylamino]butyl]phenol |
|---|---|
| PubChem CID | 71277035 |
| Molecular Formula | C20H24F3NO2 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | 2-methoxy-4-[3-methyl-3-[[4-(trifluoromethyl)phenyl]methylamino]butyl]phenol |
| SMILES | COc1cc(CCC(C)(C)NCc2ccc(C(F)(F)F)cc2)ccc1O |
| InChI | InChI=1S/C20H24F3NO2/c1-19(2,11-10-14-6-9-17(25)18(12-14)26-3)24-13-15-4-7-16(8-5-15)20(21,22)23/h4-9,12,24-25H,10-11,13H2,1-3H3 |
| InChIKey | NJBPYMPNBUEWBH-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |