C18H18F3NO4 — CID 69018228
2-hydroxy-N-[2-(4-hydroxy-3-methoxyphenyl)ethyl]-2-[4-(trifluoromethyl)phenyl]acetamide (PubChem CID 69018228) has the molecular formula C18H18F3NO4 and a molecular weight of 369.34 g/mol. Its IUPAC name is 2-hydroxy-N-[2-(4-hydroxy-3-methoxyphenyl)ethyl]-2-[4-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-hydroxy-N-[2-(4-hydroxy-3-methoxyphenyl)ethyl]-2-[4-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 69018228 |
| Molecular Formula | C18H18F3NO4 |
| Molecular Weight | 369.34 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | 2-hydroxy-N-[2-(4-hydroxy-3-methoxyphenyl)ethyl]-2-[4-(trifluoromethyl)phenyl]acetamide |
| SMILES | COc1cc(CCNC(=O)C(O)c2ccc(C(F)(F)F)cc2)ccc1O |
| InChI | InChI=1S/C18H18F3NO4/c1-26-15-10-11(2-7-14(15)23)8-9-22-17(25)16(24)12-3-5-13(6-4-12)18(19,20)21/h2-7,10,16,23-24H,8-9H2,1H3,(H,22,25) |
| InChIKey | LSMHXVBBQJKFRN-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.34 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |