C15H16ClNO4S — CID 69019591
(2R)-2-(5-chlorothiophen-2-yl)-2-hydroxy-N-[2-(4-hydroxy-3-methoxyphenyl)ethyl]acetamide (PubChem CID 69019591) has the molecular formula C15H16ClNO4S and a molecular weight of 341.82 g/mol. Its IUPAC name is (2R)-2-(5-chlorothiophen-2-yl)-2-hydroxy-N-[2-(4-hydroxy-3-methoxyphenyl)ethyl]acetamide.
| Compound Name | (2R)-2-(5-chlorothiophen-2-yl)-2-hydroxy-N-[2-(4-hydroxy-3-methoxyphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 69019591 |
| Molecular Formula | C15H16ClNO4S |
| Molecular Weight | 341.82 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | (2R)-2-(5-chlorothiophen-2-yl)-2-hydroxy-N-[2-(4-hydroxy-3-methoxyphenyl)ethyl]acetamide |
| SMILES | COc1cc(CCNC(=O)[C@@H](O)c2ccc(Cl)s2)ccc1O |
| InChI | InChI=1S/C15H16ClNO4S/c1-21-11-8-9(2-3-10(11)18)6-7-17-15(20)14(19)12-4-5-13(16)22-12/h2-5,8,14,18-19H,6-7H2,1H3,(H,17,20)/t14-/m0/s1 |
| InChIKey | APWMGHCPWKRURG-AWEZNQCLSA-N |
| XLogP | 2.51 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.82 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |