C18H21NO5 — CID 164627851
N-[2-(4-hydroxy-3-methoxyphenyl)ethyl]-2,5-dimethoxybenzamide (PubChem CID 164627851) has the molecular formula C18H21NO5 and a molecular weight of 331.37 g/mol. Its IUPAC name is N-[2-(4-hydroxy-3-methoxyphenyl)ethyl]-2,5-dimethoxybenzamide.
| Compound Name | N-[2-(4-hydroxy-3-methoxyphenyl)ethyl]-2,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 164627851 |
| Molecular Formula | C18H21NO5 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | N-[2-(4-hydroxy-3-methoxyphenyl)ethyl]-2,5-dimethoxybenzamide |
| SMILES | COc1ccc(OC)c(C(=O)NCCc2ccc(O)c(OC)c2)c1 |
| InChI | InChI=1S/C18H21NO5/c1-22-13-5-7-16(23-2)14(11-13)18(21)19-9-8-12-4-6-15(20)17(10-12)24-3/h4-7,10-11,20H,8-9H2,1-3H3,(H,19,21) |
| InChIKey | SSMOXOCXFUYHOK-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |