C21H27NO5 — CID 9474056
N-[2-(3,4-diethoxyphenyl)ethyl]-2,4-dimethoxybenzamide (PubChem CID 9474056) has the molecular formula C21H27NO5 and a molecular weight of 373.45 g/mol. Its IUPAC name is N-[2-(3,4-diethoxyphenyl)ethyl]-2,4-dimethoxybenzamide.
| Compound Name | N-[2-(3,4-diethoxyphenyl)ethyl]-2,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 9474056 |
| Molecular Formula | C21H27NO5 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | N-[2-(3,4-diethoxyphenyl)ethyl]-2,4-dimethoxybenzamide |
| SMILES | CCOc1ccc(CCNC(=O)c2ccc(OC)cc2OC)cc1OCC |
| InChI | InChI=1S/C21H27NO5/c1-5-26-18-10-7-15(13-20(18)27-6-2)11-12-22-21(23)17-9-8-16(24-3)14-19(17)25-4/h7-10,13-14H,5-6,11-12H2,1-4H3,(H,22,23) |
| InChIKey | MWIIQSOSXODQQU-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |