C26H37NO4 — CID 69035347
N-[2-(4-hydroxy-3-methoxyphenyl)ethyl]-4-methoxy-2-(2-methyloctan-4-yl)benzamide (PubChem CID 69035347) has the molecular formula C26H37NO4 and a molecular weight of 427.59 g/mol. Its IUPAC name is N-[2-(4-hydroxy-3-methoxyphenyl)ethyl]-4-methoxy-2-(2-methyloctan-4-yl)benzamide.
| Compound Name | N-[2-(4-hydroxy-3-methoxyphenyl)ethyl]-4-methoxy-2-(2-methyloctan-4-yl)benzamide |
|---|---|
| PubChem CID | 69035347 |
| Molecular Formula | C26H37NO4 |
| Molecular Weight | 427.59 g/mol |
| Exact Mass | 427.27 |
| IUPAC Name | N-[2-(4-hydroxy-3-methoxyphenyl)ethyl]-4-methoxy-2-(2-methyloctan-4-yl)benzamide |
| SMILES | CCCCC(CC(C)C)c1cc(OC)ccc1C(=O)NCCc1ccc(O)c(OC)c1 |
| InChI | InChI=1S/C26H37NO4/c1-6-7-8-20(15-18(2)3)23-17-21(30-4)10-11-22(23)26(29)27-14-13-19-9-12-24(28)25(16-19)31-5/h9-12,16-18,20,28H,6-8,13-15H2,1-5H3,(H,27,29) |
| InChIKey | QLJGJBKBWGQQBC-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.59 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |