C25H35NO3 — CID 69031246
N-[2-(4-hydroxyphenyl)ethyl]-4-methoxy-2-(2-methyloctan-4-yl)benzamide (PubChem CID 69031246) has the molecular formula C25H35NO3 and a molecular weight of 397.56 g/mol. Its IUPAC name is N-[2-(4-hydroxyphenyl)ethyl]-4-methoxy-2-(2-methyloctan-4-yl)benzamide.
| Compound Name | N-[2-(4-hydroxyphenyl)ethyl]-4-methoxy-2-(2-methyloctan-4-yl)benzamide |
|---|---|
| PubChem CID | 69031246 |
| Molecular Formula | C25H35NO3 |
| Molecular Weight | 397.56 g/mol |
| Exact Mass | 397.26 |
| IUPAC Name | N-[2-(4-hydroxyphenyl)ethyl]-4-methoxy-2-(2-methyloctan-4-yl)benzamide |
| SMILES | CCCCC(CC(C)C)c1cc(OC)ccc1C(=O)NCCc1ccc(O)cc1 |
| InChI | InChI=1S/C25H35NO3/c1-5-6-7-20(16-18(2)3)24-17-22(29-4)12-13-23(24)25(28)26-15-14-19-8-10-21(27)11-9-19/h8-13,17-18,20,27H,5-7,14-16H2,1-4H3,(H,26,28) |
| InChIKey | HWJHBWXOBZYMGP-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.56 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |