C15H17ClN2O3S — CID 95134193
1-[(1S)-1-(5-chlorothiophen-2-yl)ethyl]-3-[(3-hydroxy-4-methoxyphenyl)methyl]urea (PubChem CID 95134193) has the molecular formula C15H17ClN2O3S and a molecular weight of 340.83 g/mol. Its IUPAC name is 1-[(1S)-1-(5-chlorothiophen-2-yl)ethyl]-3-[(3-hydroxy-4-methoxyphenyl)methyl]urea.
| Compound Name | 1-[(1S)-1-(5-chlorothiophen-2-yl)ethyl]-3-[(3-hydroxy-4-methoxyphenyl)methyl]urea |
|---|---|
| PubChem CID | 95134193 |
| Molecular Formula | C15H17ClN2O3S |
| Molecular Weight | 340.83 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | 1-[(1S)-1-(5-chlorothiophen-2-yl)ethyl]-3-[(3-hydroxy-4-methoxyphenyl)methyl]urea |
| SMILES | COc1ccc(CNC(=O)N[C@@H](C)c2ccc(Cl)s2)cc1O |
| InChI | InChI=1S/C15H17ClN2O3S/c1-9(13-5-6-14(16)22-13)18-15(20)17-8-10-3-4-12(21-2)11(19)7-10/h3-7,9,19H,8H2,1-2H3,(H2,17,18,20)/t9-/m0/s1 |
| InChIKey | QBURZGTYASEQOO-VIFPVBQESA-N |
| XLogP | 3.68 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.83 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |