C15H19ClN4OS — CID 94029328
1-[(1S)-1-(5-chlorothiophen-2-yl)ethyl]-3-[[2-(dimethylamino)-4-pyridinyl]methyl]urea (PubChem CID 94029328) has the molecular formula C15H19ClN4OS and a molecular weight of 338.86 g/mol. Its IUPAC name is 1-[(1S)-1-(5-chlorothiophen-2-yl)ethyl]-3-[[2-(dimethylamino)-4-pyridinyl]methyl]urea.
| Compound Name | 1-[(1S)-1-(5-chlorothiophen-2-yl)ethyl]-3-[[2-(dimethylamino)-4-pyridinyl]methyl]urea |
|---|---|
| PubChem CID | 94029328 |
| Molecular Formula | C15H19ClN4OS |
| Molecular Weight | 338.86 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | 1-[(1S)-1-(5-chlorothiophen-2-yl)ethyl]-3-[[2-(dimethylamino)-4-pyridinyl]methyl]urea |
| SMILES | C[C@H](NC(=O)NCc1ccnc(N(C)C)c1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C15H19ClN4OS/c1-10(12-4-5-13(16)22-12)19-15(21)18-9-11-6-7-17-14(8-11)20(2)3/h4-8,10H,9H2,1-3H3,(H2,18,19,21)/t10-/m0/s1 |
| InChIKey | XRQCTKKFSHKUBL-JTQLQIEISA-N |
| XLogP | 3.42 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.86 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |