C15H18ClN3O2S — CID 99856958
1-[(1R)-1-(5-chlorothiophen-2-yl)ethyl]-3-[(1R)-1-(3-methoxy-4-pyridinyl)ethyl]urea (PubChem CID 99856958) has the molecular formula C15H18ClN3O2S and a molecular weight of 339.85 g/mol. Its IUPAC name is 1-[(1R)-1-(5-chlorothiophen-2-yl)ethyl]-3-[(1R)-1-(3-methoxy-4-pyridinyl)ethyl]urea.
| Compound Name | 1-[(1R)-1-(5-chlorothiophen-2-yl)ethyl]-3-[(1R)-1-(3-methoxy-4-pyridinyl)ethyl]urea |
|---|---|
| PubChem CID | 99856958 |
| Molecular Formula | C15H18ClN3O2S |
| Molecular Weight | 339.85 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | 1-[(1R)-1-(5-chlorothiophen-2-yl)ethyl]-3-[(1R)-1-(3-methoxy-4-pyridinyl)ethyl]urea |
| SMILES | COc1cnccc1[C@@H](C)NC(=O)N[C@H](C)c1ccc(Cl)s1 |
| InChI | InChI=1S/C15H18ClN3O2S/c1-9(11-6-7-17-8-12(11)21-3)18-15(20)19-10(2)13-4-5-14(16)22-13/h4-10H,1-3H3,(H2,18,19,20)/t9-,10-/m1/s1 |
| InChIKey | VAFBUTBSLAVKAP-NXEZZACHSA-N |
| XLogP | 3.93 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.85 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |