C15H17ClN2O2S — CID 17181700
1-[1-(5-chlorothiophen-2-yl)ethyl]-3-(2-methoxy-5-methylphenyl)urea (PubChem CID 17181700) has the molecular formula C15H17ClN2O2S and a molecular weight of 324.83 g/mol. Its IUPAC name is 1-[1-(5-chlorothiophen-2-yl)ethyl]-3-(2-methoxy-5-methylphenyl)urea.
| Compound Name | 1-[1-(5-chlorothiophen-2-yl)ethyl]-3-(2-methoxy-5-methylphenyl)urea |
|---|---|
| PubChem CID | 17181700 |
| Molecular Formula | C15H17ClN2O2S |
| Molecular Weight | 324.83 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | 1-[1-(5-chlorothiophen-2-yl)ethyl]-3-(2-methoxy-5-methylphenyl)urea |
| SMILES | COc1ccc(C)cc1NC(=O)NC(C)c1ccc(Cl)s1 |
| InChI | InChI=1S/C15H17ClN2O2S/c1-9-4-5-12(20-3)11(8-9)18-15(19)17-10(2)13-6-7-14(16)21-13/h4-8,10H,1-3H3,(H2,17,18,19) |
| InChIKey | HGSOLDDLZBCYCO-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.83 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |