C15H24N2O2 — CID 3855926
1-(3,3-dimethylbutan-2-yl)-3-(2-methoxy-5-methylphenyl)urea (PubChem CID 3855926) has the molecular formula C15H24N2O2 and a molecular weight of 264.37 g/mol. Its IUPAC name is 1-(3,3-dimethylbutan-2-yl)-3-(2-methoxy-5-methylphenyl)urea.
| Compound Name | 1-(3,3-dimethylbutan-2-yl)-3-(2-methoxy-5-methylphenyl)urea |
|---|---|
| PubChem CID | 3855926 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | 1-(3,3-dimethylbutan-2-yl)-3-(2-methoxy-5-methylphenyl)urea |
| SMILES | COc1ccc(C)cc1NC(=O)NC(C)C(C)(C)C |
| InChI | InChI=1S/C15H24N2O2/c1-10-7-8-13(19-6)12(9-10)17-14(18)16-11(2)15(3,4)5/h7-9,11H,1-6H3,(H2,16,17,18) |
| InChIKey | YXXSKCDTRMBLDS-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |