C15H17ClN2O3S — CID 29023179
1-(5-chloro-2,4-dimethoxyphenyl)-3-[(1S)-1-thiophen-2-ylethyl]urea (PubChem CID 29023179) has the molecular formula C15H17ClN2O3S and a molecular weight of 340.83 g/mol. Its IUPAC name is 1-(5-chloro-2,4-dimethoxyphenyl)-3-[(1S)-1-thiophen-2-ylethyl]urea.
| Compound Name | 1-(5-chloro-2,4-dimethoxyphenyl)-3-[(1S)-1-thiophen-2-ylethyl]urea |
|---|---|
| PubChem CID | 29023179 |
| Molecular Formula | C15H17ClN2O3S |
| Molecular Weight | 340.83 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | 1-(5-chloro-2,4-dimethoxyphenyl)-3-[(1S)-1-thiophen-2-ylethyl]urea |
| SMILES | COc1cc(OC)c(NC(=O)N[C@@H](C)c2cccs2)cc1Cl |
| InChI | InChI=1S/C15H17ClN2O3S/c1-9(14-5-4-6-22-14)17-15(19)18-11-7-10(16)12(20-2)8-13(11)21-3/h4-9H,1-3H3,(H2,17,18,19)/t9-/m0/s1 |
| InChIKey | KRJYSGUYKVLIST-VIFPVBQESA-N |
| XLogP | 4.30 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.83 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |