C13H14N2OS — CID 1158599
1-phenyl-3-[(1R)-1-thiophen-2-ylethyl]urea (PubChem CID 1158599) has the molecular formula C13H14N2OS and a molecular weight of 246.34 g/mol. Its IUPAC name is 1-phenyl-3-[(1R)-1-thiophen-2-ylethyl]urea.
| Compound Name | 1-phenyl-3-[(1R)-1-thiophen-2-ylethyl]urea |
|---|---|
| PubChem CID | 1158599 |
| Molecular Formula | C13H14N2OS |
| Molecular Weight | 246.34 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | 1-phenyl-3-[(1R)-1-thiophen-2-ylethyl]urea |
| SMILES | C[C@@H](NC(=O)Nc1ccccc1)c1cccs1 |
| InChI | InChI=1S/C13H14N2OS/c1-10(12-8-5-9-17-12)14-13(16)15-11-6-3-2-4-7-11/h2-10H,1H3,(H2,14,15,16)/t10-/m1/s1 |
| InChIKey | AVXSCMMPYVDWQV-SNVBAGLBSA-N |
| XLogP | 3.63 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.34 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |