C12H12N2O3S2 — CID 81409009
2-[[(1R)-1-thiophen-2-ylethyl]carbamoylamino]thiophene-3-carboxylic acid (PubChem CID 81409009) has the molecular formula C12H12N2O3S2 and a molecular weight of 296.37 g/mol. Its IUPAC name is 2-[[(1R)-1-thiophen-2-ylethyl]carbamoylamino]thiophene-3-carboxylic acid.
| Compound Name | 2-[[(1R)-1-thiophen-2-ylethyl]carbamoylamino]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 81409009 |
| Molecular Formula | C12H12N2O3S2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.03 |
| IUPAC Name | 2-[[(1R)-1-thiophen-2-ylethyl]carbamoylamino]thiophene-3-carboxylic acid |
| SMILES | C[C@@H](NC(=O)Nc1sccc1C(=O)O)c1cccs1 |
| InChI | InChI=1S/C12H12N2O3S2/c1-7(9-3-2-5-18-9)13-12(17)14-10-8(11(15)16)4-6-19-10/h2-7H,1H3,(H,15,16)(H2,13,14,17)/t7-/m1/s1 |
| InChIKey | XTQONJPGHGZISW-SSDOTTSWSA-N |
| XLogP | 3.39 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |