C10H14N2O4S — CID 83186689
2-(4-hydroxybutan-2-ylcarbamoylamino)thiophene-3-carboxylic acid (PubChem CID 83186689) has the molecular formula C10H14N2O4S and a molecular weight of 258.30 g/mol. Its IUPAC name is 2-(4-hydroxybutan-2-ylcarbamoylamino)thiophene-3-carboxylic acid.
| Compound Name | 2-(4-hydroxybutan-2-ylcarbamoylamino)thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 83186689 |
| Molecular Formula | C10H14N2O4S |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 2-(4-hydroxybutan-2-ylcarbamoylamino)thiophene-3-carboxylic acid |
| SMILES | CC(CCO)NC(=O)Nc1sccc1C(=O)O |
| InChI | InChI=1S/C10H14N2O4S/c1-6(2-4-13)11-10(16)12-8-7(9(14)15)3-5-17-8/h3,5-6,13H,2,4H2,1H3,(H,14,15)(H2,11,12,16) |
| InChIKey | ICMBQAJYUWXOOV-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |