C11H16N2O3S2 — CID 113494919
2-(1-methylsulfanylbutan-2-ylcarbamoylamino)thiophene-3-carboxylic acid (PubChem CID 113494919) has the molecular formula C11H16N2O3S2 and a molecular weight of 288.39 g/mol. Its IUPAC name is 2-(1-methylsulfanylbutan-2-ylcarbamoylamino)thiophene-3-carboxylic acid.
| Compound Name | 2-(1-methylsulfanylbutan-2-ylcarbamoylamino)thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 113494919 |
| Molecular Formula | C11H16N2O3S2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | 2-(1-methylsulfanylbutan-2-ylcarbamoylamino)thiophene-3-carboxylic acid |
| SMILES | CCC(CSC)NC(=O)Nc1sccc1C(=O)O |
| InChI | InChI=1S/C11H16N2O3S2/c1-3-7(6-17-2)12-11(16)13-9-8(10(14)15)4-5-18-9/h4-5,7H,3,6H2,1-2H3,(H,14,15)(H2,12,13,16) |
| InChIKey | NJJFNIUNGBCSMD-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |