C13H19N3O4S — CID 63114207
2-[[4-methyl-1-(methylamino)-1-oxopentan-2-yl]carbamoylamino]thiophene-3-carboxylic acid (PubChem CID 63114207) has the molecular formula C13H19N3O4S and a molecular weight of 313.38 g/mol. Its IUPAC name is 2-[[4-methyl-1-(methylamino)-1-oxopentan-2-yl]carbamoylamino]thiophene-3-carboxylic acid.
| Compound Name | 2-[[4-methyl-1-(methylamino)-1-oxopentan-2-yl]carbamoylamino]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 63114207 |
| Molecular Formula | C13H19N3O4S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 2-[[4-methyl-1-(methylamino)-1-oxopentan-2-yl]carbamoylamino]thiophene-3-carboxylic acid |
| SMILES | CNC(=O)C(CC(C)C)NC(=O)Nc1sccc1C(=O)O |
| InChI | InChI=1S/C13H19N3O4S/c1-7(2)6-9(10(17)14-3)15-13(20)16-11-8(12(18)19)4-5-21-11/h4-5,7,9H,6H2,1-3H3,(H,14,17)(H,18,19)(H2,15,16,20) |
| InChIKey | NAFWJSKJDIQABL-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |