C10H14N4O3S — CID 36974814
2-[[(1R)-1-thiophen-2-ylethyl]carbamoylamino]propanediamide (PubChem CID 36974814) has the molecular formula C10H14N4O3S and a molecular weight of 270.31 g/mol. Its IUPAC name is 2-[[(1R)-1-thiophen-2-ylethyl]carbamoylamino]propanediamide.
| Compound Name | 2-[[(1R)-1-thiophen-2-ylethyl]carbamoylamino]propanediamide |
|---|---|
| PubChem CID | 36974814 |
| Molecular Formula | C10H14N4O3S |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | 2-[[(1R)-1-thiophen-2-ylethyl]carbamoylamino]propanediamide |
| SMILES | C[C@@H](NC(=O)NC(C(N)=O)C(N)=O)c1cccs1 |
| InChI | InChI=1S/C10H14N4O3S/c1-5(6-3-2-4-18-6)13-10(17)14-7(8(11)15)9(12)16/h2-5,7H,1H3,(H2,11,15)(H2,12,16)(H2,13,14,17)/t5-/m1/s1 |
| InChIKey | ZISPQRJBFIFXDU-RXMQYKEDSA-N |
| XLogP | -0.55 |
| TPSA | 127.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|