C12H20N2O3S2 — CID 97227304
1-[(2S)-4-methylsulfonylbutan-2-yl]-3-[(1R)-1-thiophen-2-ylethyl]urea (PubChem CID 97227304) has the molecular formula C12H20N2O3S2 and a molecular weight of 304.44 g/mol. Its IUPAC name is 1-[(2S)-4-methylsulfonylbutan-2-yl]-3-[(1R)-1-thiophen-2-ylethyl]urea.
| Compound Name | 1-[(2S)-4-methylsulfonylbutan-2-yl]-3-[(1R)-1-thiophen-2-ylethyl]urea |
|---|---|
| PubChem CID | 97227304 |
| Molecular Formula | C12H20N2O3S2 |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 1-[(2S)-4-methylsulfonylbutan-2-yl]-3-[(1R)-1-thiophen-2-ylethyl]urea |
| SMILES | C[C@@H](CCS(C)(=O)=O)NC(=O)N[C@H](C)c1cccs1 |
| InChI | InChI=1S/C12H20N2O3S2/c1-9(6-8-19(3,16)17)13-12(15)14-10(2)11-5-4-7-18-11/h4-5,7,9-10H,6,8H2,1-3H3,(H2,13,14,15)/t9-,10+/m0/s1 |
| InChIKey | AROOUAXNOCSRJE-VHSXEESVSA-N |
| XLogP | 1.93 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |