C12H18N2O3S2 — CID 104909910
(2R)-4-methylsulfanyl-2-(1-thiophen-2-ylethylcarbamoylamino)butanoic acid (PubChem CID 104909910) has the molecular formula C12H18N2O3S2 and a molecular weight of 302.42 g/mol. Its IUPAC name is (2R)-4-methylsulfanyl-2-(1-thiophen-2-ylethylcarbamoylamino)butanoic acid.
| Compound Name | (2R)-4-methylsulfanyl-2-(1-thiophen-2-ylethylcarbamoylamino)butanoic acid |
|---|---|
| PubChem CID | 104909910 |
| Molecular Formula | C12H18N2O3S2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | (2R)-4-methylsulfanyl-2-(1-thiophen-2-ylethylcarbamoylamino)butanoic acid |
| SMILES | CSCC[C@@H](NC(=O)NC(C)c1cccs1)C(=O)O |
| InChI | InChI=1S/C12H18N2O3S2/c1-8(10-4-3-6-19-10)13-12(17)14-9(11(15)16)5-7-18-2/h3-4,6,8-9H,5,7H2,1-2H3,(H,15,16)(H2,13,14,17)/t8?,9-/m1/s1 |
| InChIKey | IMNPWKROQHOLFE-YGPZHTELSA-N |
| XLogP | 2.31 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |