C24H37NO2 — CID 144539772
4-[3-[(4-tert-butylphenyl)methylamino]butyl]-2-methoxyphenol;ethane (PubChem CID 144539772) has the molecular formula C24H37NO2 and a molecular weight of 371.57 g/mol. Its IUPAC name is 4-[3-[(4-tert-butylphenyl)methylamino]butyl]-2-methoxyphenol;ethane.
| Compound Name | 4-[3-[(4-tert-butylphenyl)methylamino]butyl]-2-methoxyphenol;ethane |
|---|---|
| PubChem CID | 144539772 |
| Molecular Formula | C24H37NO2 |
| Molecular Weight | 371.57 g/mol |
| Exact Mass | 371.28 |
| IUPAC Name | 4-[3-[(4-tert-butylphenyl)methylamino]butyl]-2-methoxyphenol;ethane |
| SMILES | CC.COc1cc(CCC(C)NCc2ccc(C(C)(C)C)cc2)ccc1O |
| InChI | InChI=1S/C22H31NO2.C2H6/c1-16(6-7-17-10-13-20(24)21(14-17)25-5)23-15-18-8-11-19(12-9-18)22(2,3)4;1-2/h8-14,16,23-24H,6-7,15H2,1-5H3;1-2H3 |
| InChIKey | GSWQEZYEMQIVBJ-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.57 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |