C12H14F3NO — CID 134817377
N-[[2-methoxy-5-(trifluoromethyl)phenyl]methyl]cyclopropanamine (PubChem CID 134817377) has the molecular formula C12H14F3NO and a molecular weight of 245.24 g/mol. Its IUPAC name is N-[[2-methoxy-5-(trifluoromethyl)phenyl]methyl]cyclopropanamine.
| Compound Name | N-[[2-methoxy-5-(trifluoromethyl)phenyl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 134817377 |
| Molecular Formula | C12H14F3NO |
| Molecular Weight | 245.24 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | N-[[2-methoxy-5-(trifluoromethyl)phenyl]methyl]cyclopropanamine |
| SMILES | COc1ccc(C(F)(F)F)cc1CNC1CC1 |
| InChI | InChI=1S/C12H14F3NO/c1-17-11-5-2-9(12(13,14)15)6-8(11)7-16-10-3-4-10/h2,5-6,10,16H,3-4,7H2,1H3 |
| InChIKey | WVFZWKKDWAALRT-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.24 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |