About 1-[2-methoxy-5-[4-(trifluoromethyl)phenyl]phenyl]-N,N-dimethylbutan-2-amine
1-[2-methoxy-5-[4-(trifluoromethyl)phenyl]phenyl]-N,N-dimethylbutan-2-amine (PubChem CID 70283976) has the molecular formula C20H24F3NO
and a molecular weight of 351.41 g/mol. Its IUPAC name is 1-[2-methoxy-5-[4-(trifluoromethyl)phenyl]phenyl]-N,N-dimethylbutan-2-amine.
Molecular Properties
| Compound Name | 1-[2-methoxy-5-[4-(trifluoromethyl)phenyl]phenyl]-N,N-dimethylbutan-2-amine |
| PubChem CID | 70283976 |
| Molecular Formula | C20H24F3NO |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | 1-[2-methoxy-5-[4-(trifluoromethyl)phenyl]phenyl]-N,N-dimethylbutan-2-amine |
| SMILES | CCC(Cc1cc(-c2ccc(C(F)(F)F)cc2)ccc1OC)N(C)C |
| InChI | InChI=1S/C20H24F3NO/c1-5-18(24(2)3)13-16-12-15(8-11-19(16)25-4)14-6-9-17(10-7-14)20(21,22)23/h6-12,18H,5,13H2,1-4H3 |
| InChIKey | RJISIERVOLOPGE-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[2-methoxy-5-[4-(trifluoromethyl)phenyl]phenyl]-N,N-dimethylbutan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-methoxy-5-[4-(trifluoromethyl)phenyl]phenyl]-N,N-dimethylbutan-2-amine?
The IUPAC name of 1-[2-methoxy-5-[4-(trifluoromethyl)phenyl]phenyl]-N,N-dimethylbutan-2-amine (CID 70283976) is 1-[2-methoxy-5-[4-(trifluoromethyl)phenyl]phenyl]-N,N-dimethylbutan-2-amine.
What is the SMILES notation for 1-[2-methoxy-5-[4-(trifluoromethyl)phenyl]phenyl]-N,N-dimethylbutan-2-amine?
The canonical SMILES for 1-[2-methoxy-5-[4-(trifluoromethyl)phenyl]phenyl]-N,N-dimethylbutan-2-amine is CCC(Cc1cc(-c2ccc(C(F)(F)F)cc2)ccc1OC)N(C)C.
What is the InChIKey of 1-[2-methoxy-5-[4-(trifluoromethyl)phenyl]phenyl]-N,N-dimethylbutan-2-amine?
The InChIKey is RJISIERVOLOPGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24F3NO/c1-5-18(24(2)3)13-16-12-15(8-11-19(16)25-4)14-6-9-17(10-7-14)20(21,22)23/h6-12,18H,5,13H2,1-4H3.
What are the key properties of 1-[2-methoxy-5-[4-(trifluoromethyl)phenyl]phenyl]-N,N-dimethylbutan-2-amine?
1-[2-methoxy-5-[4-(trifluoromethyl)phenyl]phenyl]-N,N-dimethylbutan-2-amine has a molecular weight of 351.41 g/mol, XLogP of 5.26, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-methoxy-5-[4-(trifluoromethyl)phenyl]phenyl]-N,N-dimethylbutan-2-amine is sourced from PubChem (CID 70283976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).