C22H22F3NO3 — CID 70285470
1-[2-[2-methoxy-5-[4-(trifluoromethyl)phenyl]phenyl]propyl]piperidine-2,6-dione (PubChem CID 70285470) has the molecular formula C22H22F3NO3 and a molecular weight of 405.42 g/mol. Its IUPAC name is 1-[2-[2-methoxy-5-[4-(trifluoromethyl)phenyl]phenyl]propyl]piperidine-2,6-dione.
| Compound Name | 1-[2-[2-methoxy-5-[4-(trifluoromethyl)phenyl]phenyl]propyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 70285470 |
| Molecular Formula | C22H22F3NO3 |
| Molecular Weight | 405.42 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | 1-[2-[2-methoxy-5-[4-(trifluoromethyl)phenyl]phenyl]propyl]piperidine-2,6-dione |
| SMILES | COc1ccc(-c2ccc(C(F)(F)F)cc2)cc1C(C)CN1C(=O)CCCC1=O |
| InChI | InChI=1S/C22H22F3NO3/c1-14(13-26-20(27)4-3-5-21(26)28)18-12-16(8-11-19(18)29-2)15-6-9-17(10-7-15)22(23,24)25/h6-12,14H,3-5,13H2,1-2H3 |
| InChIKey | WQXIHKXGNFTFQB-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.42 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|