C24H24F3N2O3S+ — CID 70282800
(2S)-3-[2-methoxy-5-[4-(trifluoromethyl)phenyl]phenyl]-4-methylsulfanyl-2-(pyridin-1-ium-1-ylamino)butanoic acid (PubChem CID 70282800) has the molecular formula C24H24F3N2O3S+ and a molecular weight of 477.53 g/mol. Its IUPAC name is (2S)-3-[2-methoxy-5-[4-(trifluoromethyl)phenyl]phenyl]-4-methylsulfanyl-2-(pyridin-1-ium-1-ylamino)butanoic acid.
| Compound Name | (2S)-3-[2-methoxy-5-[4-(trifluoromethyl)phenyl]phenyl]-4-methylsulfanyl-2-(pyridin-1-ium-1-ylamino)butanoic acid |
|---|---|
| PubChem CID | 70282800 |
| Molecular Formula | C24H24F3N2O3S+ |
| Molecular Weight | 477.53 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | (2S)-3-[2-methoxy-5-[4-(trifluoromethyl)phenyl]phenyl]-4-methylsulfanyl-2-(pyridin-1-ium-1-ylamino)butanoic acid |
| SMILES | COc1ccc(-c2ccc(C(F)(F)F)cc2)cc1C(CSC)[C@H](N[n+]1ccccc1)C(=O)O |
| InChI | InChI=1S/C24H23F3N2O3S/c1-32-21-11-8-17(16-6-9-18(10-7-16)24(25,26)27)14-19(21)20(15-33-2)22(23(30)31)28-29-12-4-3-5-13-29/h3-14,20,22,28H,15H2,1-2H3/p+1/t20?,22-/m0/s1 |
| InChIKey | XZBAOFBYXUNHJY-IAXKEJLGSA-O |
| XLogP | 4.81 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.53 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|