C19H28N4O3 — CID 111501517
1-[2-(2,6-dioxopiperidin-1-yl)ethyl]-3-[1-(2-methoxy-5-methylphenyl)ethyl]-2-methylguanidine (PubChem CID 111501517) has the molecular formula C19H28N4O3 and a molecular weight of 360.46 g/mol. Its IUPAC name is 1-[2-(2,6-dioxopiperidin-1-yl)ethyl]-3-[1-(2-methoxy-5-methylphenyl)ethyl]-2-methylguanidine.
| Compound Name | 1-[2-(2,6-dioxopiperidin-1-yl)ethyl]-3-[1-(2-methoxy-5-methylphenyl)ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111501517 |
| Molecular Formula | C19H28N4O3 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | 1-[2-(2,6-dioxopiperidin-1-yl)ethyl]-3-[1-(2-methoxy-5-methylphenyl)ethyl]-2-methylguanidine |
| SMILES | C/N=C(\NCCN1C(=O)CCCC1=O)NC(C)c1cc(C)ccc1OC |
| InChI | InChI=1S/C19H28N4O3/c1-13-8-9-16(26-4)15(12-13)14(2)22-19(20-3)21-10-11-23-17(24)6-5-7-18(23)25/h8-9,12,14H,5-7,10-11H2,1-4H3,(H2,20,21,22) |
| InChIKey | KODKQJLTXFLDDY-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|