C17H23BrN4O2 — CID 111500991
1-[1-(2-bromophenyl)ethyl]-3-[2-(2,6-dioxopiperidin-1-yl)ethyl]-2-methylguanidine (PubChem CID 111500991) has the molecular formula C17H23BrN4O2 and a molecular weight of 395.30 g/mol. Its IUPAC name is 1-[1-(2-bromophenyl)ethyl]-3-[2-(2,6-dioxopiperidin-1-yl)ethyl]-2-methylguanidine.
| Compound Name | 1-[1-(2-bromophenyl)ethyl]-3-[2-(2,6-dioxopiperidin-1-yl)ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111500991 |
| Molecular Formula | C17H23BrN4O2 |
| Molecular Weight | 395.30 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | 1-[1-(2-bromophenyl)ethyl]-3-[2-(2,6-dioxopiperidin-1-yl)ethyl]-2-methylguanidine |
| SMILES | C/N=C(/NCCN1C(=O)CCCC1=O)NC(C)c1ccccc1Br |
| InChI | InChI=1S/C17H23BrN4O2/c1-12(13-6-3-4-7-14(13)18)21-17(19-2)20-10-11-22-15(23)8-5-9-16(22)24/h3-4,6-7,12H,5,8-11H2,1-2H3,(H2,19,20,21) |
| InChIKey | HWOJLMRDSDVGSX-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.30 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|