C17H26BrIN6 — CID 119159586
1-[1-(2-bromophenyl)ethyl]-3-[[2-(dimethylamino)-3-methylimidazol-4-yl]methyl]-2-methylguanidine;hydroiodide (PubChem CID 119159586) has the molecular formula C17H26BrIN6 and a molecular weight of 521.25 g/mol. Its IUPAC name is 1-[1-(2-bromophenyl)ethyl]-3-[[2-(dimethylamino)-3-methylimidazol-4-yl]methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[1-(2-bromophenyl)ethyl]-3-[[2-(dimethylamino)-3-methylimidazol-4-yl]methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 119159586 |
| Molecular Formula | C17H26BrIN6 |
| Molecular Weight | 521.25 g/mol |
| Exact Mass | 520.04 |
| IUPAC Name | 1-[1-(2-bromophenyl)ethyl]-3-[[2-(dimethylamino)-3-methylimidazol-4-yl]methyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCc1cnc(N(C)C)n1C)NC(C)c1ccccc1Br.I |
| InChI | InChI=1S/C17H25BrN6.HI/c1-12(14-8-6-7-9-15(14)18)22-16(19-2)20-10-13-11-21-17(23(3)4)24(13)5;/h6-9,11-12H,10H2,1-5H3,(H2,19,20,22);1H |
| InChIKey | RGIMDGVIMIJHDT-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 57.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.25 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|