C13H17BrF3N3 — CID 111984491
1-[1-(2-bromophenyl)ethyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine (PubChem CID 111984491) has the molecular formula C13H17BrF3N3 and a molecular weight of 352.20 g/mol. Its IUPAC name is 1-[1-(2-bromophenyl)ethyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine.
| Compound Name | 1-[1-(2-bromophenyl)ethyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine |
|---|---|
| PubChem CID | 111984491 |
| Molecular Formula | C13H17BrF3N3 |
| Molecular Weight | 352.20 g/mol |
| Exact Mass | 351.06 |
| IUPAC Name | 1-[1-(2-bromophenyl)ethyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine |
| SMILES | C/N=C(\NCCC(F)(F)F)NC(C)c1ccccc1Br |
| InChI | InChI=1S/C13H17BrF3N3/c1-9(10-5-3-4-6-11(10)14)20-12(18-2)19-8-7-13(15,16)17/h3-6,9H,7-8H2,1-2H3,(H2,18,19,20) |
| InChIKey | HJTKZMXUKCDHQX-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.20 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|