C16H26F3IN4 — CID 109475000
1-(2-anilino-3-methylbutyl)-2-methyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide (PubChem CID 109475000) has the molecular formula C16H26F3IN4 and a molecular weight of 458.31 g/mol. Its IUPAC name is 1-(2-anilino-3-methylbutyl)-2-methyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide.
| Compound Name | 1-(2-anilino-3-methylbutyl)-2-methyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109475000 |
| Molecular Formula | C16H26F3IN4 |
| Molecular Weight | 458.31 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | 1-(2-anilino-3-methylbutyl)-2-methyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCC(F)(F)F)NCC(Nc1ccccc1)C(C)C.I |
| InChI | InChI=1S/C16H25F3N4.HI/c1-12(2)14(23-13-7-5-4-6-8-13)11-22-15(20-3)21-10-9-16(17,18)19;/h4-8,12,14,23H,9-11H2,1-3H3,(H2,20,21,22);1H |
| InChIKey | AVWRSNSWUGHQOS-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 48.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.31 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|