C17H27F3IN3 — CID 111989750
1-(2-ethyl-2-phenylbutyl)-2-methyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide (PubChem CID 111989750) has the molecular formula C17H27F3IN3 and a molecular weight of 457.32 g/mol. Its IUPAC name is 1-(2-ethyl-2-phenylbutyl)-2-methyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide.
| Compound Name | 1-(2-ethyl-2-phenylbutyl)-2-methyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111989750 |
| Molecular Formula | C17H27F3IN3 |
| Molecular Weight | 457.32 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | 1-(2-ethyl-2-phenylbutyl)-2-methyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
| SMILES | CCC(CC)(CN/C(=N/C)NCCC(F)(F)F)c1ccccc1.I |
| InChI | InChI=1S/C17H26F3N3.HI/c1-4-16(5-2,14-9-7-6-8-10-14)13-23-15(21-3)22-12-11-17(18,19)20;/h6-10H,4-5,11-13H2,1-3H3,(H2,21,22,23);1H |
| InChIKey | CSCPEDOOTQXJIC-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.32 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|