C21H33F3N4 — CID 111694590
1-(2-ethyl-2-phenylbutyl)-2-methyl-3-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]guanidine (PubChem CID 111694590) has the molecular formula C21H33F3N4 and a molecular weight of 398.52 g/mol. Its IUPAC name is 1-(2-ethyl-2-phenylbutyl)-2-methyl-3-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]guanidine.
| Compound Name | 1-(2-ethyl-2-phenylbutyl)-2-methyl-3-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]guanidine |
|---|---|
| PubChem CID | 111694590 |
| Molecular Formula | C21H33F3N4 |
| Molecular Weight | 398.52 g/mol |
| Exact Mass | 398.27 |
| IUPAC Name | 1-(2-ethyl-2-phenylbutyl)-2-methyl-3-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]guanidine |
| SMILES | CCC(CC)(CN/C(=N/C)NCC1CCN(CC(F)(F)F)C1)c1ccccc1 |
| InChI | InChI=1S/C21H33F3N4/c1-4-20(5-2,18-9-7-6-8-10-18)15-27-19(25-3)26-13-17-11-12-28(14-17)16-21(22,23)24/h6-10,17H,4-5,11-16H2,1-3H3,(H2,25,26,27) |
| InChIKey | UKYHMKZMUAWODK-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.52 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|