C14H20ClF3IN3 — CID 109471550
1-[3-(2-chlorophenyl)propyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide (PubChem CID 109471550) has the molecular formula C14H20ClF3IN3 and a molecular weight of 449.69 g/mol. Its IUPAC name is 1-[3-(2-chlorophenyl)propyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide.
| Compound Name | 1-[3-(2-chlorophenyl)propyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109471550 |
| Molecular Formula | C14H20ClF3IN3 |
| Molecular Weight | 449.69 g/mol |
| Exact Mass | 449.03 |
| IUPAC Name | 1-[3-(2-chlorophenyl)propyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCCCc1ccccc1Cl)NCCC(F)(F)F.I |
| InChI | InChI=1S/C14H19ClF3N3.HI/c1-19-13(21-10-8-14(16,17)18)20-9-4-6-11-5-2-3-7-12(11)15;/h2-3,5,7H,4,6,8-10H2,1H3,(H2,19,20,21);1H |
| InChIKey | NIGLCTNMFXSNCF-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.69 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|