C17H23FN4O2 — CID 111501569
1-[2-(2,6-dioxopiperidin-1-yl)ethyl]-3-[2-(3-fluorophenyl)ethyl]-2-methylguanidine (PubChem CID 111501569) has the molecular formula C17H23FN4O2 and a molecular weight of 334.39 g/mol. Its IUPAC name is 1-[2-(2,6-dioxopiperidin-1-yl)ethyl]-3-[2-(3-fluorophenyl)ethyl]-2-methylguanidine.
| Compound Name | 1-[2-(2,6-dioxopiperidin-1-yl)ethyl]-3-[2-(3-fluorophenyl)ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111501569 |
| Molecular Formula | C17H23FN4O2 |
| Molecular Weight | 334.39 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | 1-[2-(2,6-dioxopiperidin-1-yl)ethyl]-3-[2-(3-fluorophenyl)ethyl]-2-methylguanidine |
| SMILES | C/N=C(\NCCc1cccc(F)c1)NCCN1C(=O)CCCC1=O |
| InChI | InChI=1S/C17H23FN4O2/c1-19-17(20-9-8-13-4-2-5-14(18)12-13)21-10-11-22-15(23)6-3-7-16(22)24/h2,4-5,12H,3,6-11H2,1H3,(H2,19,20,21) |
| InChIKey | UBDHHSQBAPHBES-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.39 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|