C20H25F5 — CID 156727058
2,4-difluoro-1-(2-methylpropyl)benzene;ethane;5-ethyl-1,2,3-trifluorobenzene (PubChem CID 156727058) has the molecular formula C20H25F5 and a molecular weight of 360.41 g/mol. Its IUPAC name is 2,4-difluoro-1-(2-methylpropyl)benzene;ethane;5-ethyl-1,2,3-trifluorobenzene.
| Compound Name | 2,4-difluoro-1-(2-methylpropyl)benzene;ethane;5-ethyl-1,2,3-trifluorobenzene |
|---|---|
| PubChem CID | 156727058 |
| Molecular Formula | C20H25F5 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | 2,4-difluoro-1-(2-methylpropyl)benzene;ethane;5-ethyl-1,2,3-trifluorobenzene |
| SMILES | CC.CC(C)Cc1ccc(F)cc1F.CCc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C10H12F2.C8H7F3.C2H6/c1-7(2)5-8-3-4-9(11)6-10(8)12;1-2-5-3-6(9)8(11)7(10)4-5;1-2/h3-4,6-7H,5H2,1-2H3;3-4H,2H2,1H3;1-2H3 |
| InChIKey | YURBGXBLOHUSBB-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|