C11H11F6N — CID 132588639
1,1,1-trifluoro-3-methyl-3-(2,4,5-trifluorophenyl)butan-2-amine (PubChem CID 132588639) has the molecular formula C11H11F6N and a molecular weight of 271.20 g/mol. Its IUPAC name is 1,1,1-trifluoro-3-methyl-3-(2,4,5-trifluorophenyl)butan-2-amine.
| Compound Name | 1,1,1-trifluoro-3-methyl-3-(2,4,5-trifluorophenyl)butan-2-amine |
|---|---|
| PubChem CID | 132588639 |
| Molecular Formula | C11H11F6N |
| Molecular Weight | 271.20 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 1,1,1-trifluoro-3-methyl-3-(2,4,5-trifluorophenyl)butan-2-amine |
| SMILES | CC(C)(c1cc(F)c(F)cc1F)C(N)C(F)(F)F |
| InChI | InChI=1S/C11H11F6N/c1-10(2,9(18)11(15,16)17)5-3-7(13)8(14)4-6(5)12/h3-4,9H,18H2,1-2H3 |
| InChIKey | GERGNBKHKIEFPP-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.20 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|